C13H13FN4O3S — CID 67040350
N-(5-tert-butyl-1,3,4-thiadiazol-2-yl)-4-fluoro-3-nitrobenzamide (PubChem CID 67040350) has the molecular formula C13H13FN4O3S and a molecular weight of 324.34 g/mol. Its IUPAC name is N-(5-tert-butyl-1,3,4-thiadiazol-2-yl)-4-fluoro-3-nitrobenzamide.
| Compound Name | N-(5-tert-butyl-1,3,4-thiadiazol-2-yl)-4-fluoro-3-nitrobenzamide |
|---|---|
| PubChem CID | 67040350 |
| Molecular Formula | C13H13FN4O3S |
| Molecular Weight | 324.34 g/mol |
| Exact Mass | 324.07 |
| IUPAC Name | N-(5-tert-butyl-1,3,4-thiadiazol-2-yl)-4-fluoro-3-nitrobenzamide |
| SMILES | CC(C)(C)c1nnc(NC(=O)c2ccc(F)c([N+](=O)[O-])c2)s1 |
| InChI | InChI=1S/C13H13FN4O3S/c1-13(2,3)11-16-17-12(22-11)15-10(19)7-4-5-8(14)9(6-7)18(20)21/h4-6H,1-3H3,(H,15,17,19) |
| InChIKey | FEDUHTRKTZRSNP-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 98.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.34 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|