C17H14F4N2O3S — CID 126479526
4-fluoro-3-(prop-2-enylsulfamoyl)-N-[2-(trifluoromethyl)phenyl]benzamide (PubChem CID 126479526) has the molecular formula C17H14F4N2O3S and a molecular weight of 402.37 g/mol. Its IUPAC name is 4-fluoro-3-(prop-2-enylsulfamoyl)-N-[2-(trifluoromethyl)phenyl]benzamide.
| Compound Name | 4-fluoro-3-(prop-2-enylsulfamoyl)-N-[2-(trifluoromethyl)phenyl]benzamide |
|---|---|
| PubChem CID | 126479526 |
| Molecular Formula | C17H14F4N2O3S |
| Molecular Weight | 402.37 g/mol |
| Exact Mass | 402.07 |
| IUPAC Name | 4-fluoro-3-(prop-2-enylsulfamoyl)-N-[2-(trifluoromethyl)phenyl]benzamide |
| SMILES | C=CCNS(=O)(=O)c1cc(C(=O)Nc2ccccc2C(F)(F)F)ccc1F |
| InChI | InChI=1S/C17H14F4N2O3S/c1-2-9-22-27(25,26)15-10-11(7-8-13(15)18)16(24)23-14-6-4-3-5-12(14)17(19,20)21/h2-8,10,22H,1,9H2,(H,23,24) |
| InChIKey | RCOFPHACYKOSGN-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.37 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|