C20H15Cl2FN2O3S — CID 3689795
N-(2-chlorophenyl)-3-[(2-chlorophenyl)methylsulfamoyl]-4-fluorobenzamide (PubChem CID 3689795) has the molecular formula C20H15Cl2FN2O3S and a molecular weight of 453.32 g/mol. Its IUPAC name is N-(2-chlorophenyl)-3-[(2-chlorophenyl)methylsulfamoyl]-4-fluorobenzamide.
| Compound Name | N-(2-chlorophenyl)-3-[(2-chlorophenyl)methylsulfamoyl]-4-fluorobenzamide |
|---|---|
| PubChem CID | 3689795 |
| Molecular Formula | C20H15Cl2FN2O3S |
| Molecular Weight | 453.32 g/mol |
| Exact Mass | 452.02 |
| IUPAC Name | N-(2-chlorophenyl)-3-[(2-chlorophenyl)methylsulfamoyl]-4-fluorobenzamide |
| SMILES | O=C(Nc1ccccc1Cl)c1ccc(F)c(S(=O)(=O)NCc2ccccc2Cl)c1 |
| InChI | InChI=1S/C20H15Cl2FN2O3S/c21-15-6-2-1-5-14(15)12-24-29(27,28)19-11-13(9-10-17(19)23)20(26)25-18-8-4-3-7-16(18)22/h1-11,24H,12H2,(H,25,26) |
| InChIKey | LKMAXQRCSWDGDS-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.32 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |