C13H10Cl3NO2S — CID 125467959
2,4-dichloro-N-[(2-chlorophenyl)methyl]benzenesulfonamide (PubChem CID 125467959) has the molecular formula C13H10Cl3NO2S and a molecular weight of 350.65 g/mol. Its IUPAC name is 2,4-dichloro-N-[(2-chlorophenyl)methyl]benzenesulfonamide.
| Compound Name | 2,4-dichloro-N-[(2-chlorophenyl)methyl]benzenesulfonamide |
|---|---|
| PubChem CID | 125467959 |
| Molecular Formula | C13H10Cl3NO2S |
| Molecular Weight | 350.65 g/mol |
| Exact Mass | 348.95 |
| IUPAC Name | 2,4-dichloro-N-[(2-chlorophenyl)methyl]benzenesulfonamide |
| SMILES | O=S(=O)(NCc1ccccc1Cl)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C13H10Cl3NO2S/c14-10-5-6-13(12(16)7-10)20(18,19)17-8-9-3-1-2-4-11(9)15/h1-7,17H,8H2 |
| InChIKey | OUFUQAXMPROFEC-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.65 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |