C13H8Cl3F2NO2S — CID 3710216
2,4-dichloro-N-[(3-chloro-2,6-difluorophenyl)methyl]benzenesulfonamide (PubChem CID 3710216) has the molecular formula C13H8Cl3F2NO2S and a molecular weight of 386.63 g/mol. Its IUPAC name is 2,4-dichloro-N-[(3-chloro-2,6-difluorophenyl)methyl]benzenesulfonamide.
| Compound Name | 2,4-dichloro-N-[(3-chloro-2,6-difluorophenyl)methyl]benzenesulfonamide |
|---|---|
| PubChem CID | 3710216 |
| Molecular Formula | C13H8Cl3F2NO2S |
| Molecular Weight | 386.63 g/mol |
| Exact Mass | 384.93 |
| IUPAC Name | 2,4-dichloro-N-[(3-chloro-2,6-difluorophenyl)methyl]benzenesulfonamide |
| SMILES | O=S(=O)(NCc1c(F)ccc(Cl)c1F)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C13H8Cl3F2NO2S/c14-7-1-4-12(10(16)5-7)22(20,21)19-6-8-11(17)3-2-9(15)13(8)18/h1-5,19H,6H2 |
| InChIKey | GVIFOSASPXVLBW-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.63 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|