C8H7Cl2NO3S — CID 143489858
2,4-dichloro-N-(2-oxoethyl)benzenesulfonamide (PubChem CID 143489858) has the molecular formula C8H7Cl2NO3S and a molecular weight of 268.12 g/mol. Its IUPAC name is 2,4-dichloro-N-(2-oxoethyl)benzenesulfonamide.
| Compound Name | 2,4-dichloro-N-(2-oxoethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 143489858 |
| Molecular Formula | C8H7Cl2NO3S |
| Molecular Weight | 268.12 g/mol |
| Exact Mass | 266.95 |
| IUPAC Name | 2,4-dichloro-N-(2-oxoethyl)benzenesulfonamide |
| SMILES | O=CCNS(=O)(=O)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C8H7Cl2NO3S/c9-6-1-2-8(7(10)5-6)15(13,14)11-3-4-12/h1-2,4-5,11H,3H2 |
| InChIKey | AQILSDMYIMRSPW-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.12 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|