C6H5Cl2NO3S — CID 83542895
2,4-dichloro-N-hydroxybenzenesulfonamide (PubChem CID 83542895) has the molecular formula C6H5Cl2NO3S and a molecular weight of 242.08 g/mol. Its IUPAC name is 2,4-dichloro-N-hydroxybenzenesulfonamide.
| Compound Name | 2,4-dichloro-N-hydroxybenzenesulfonamide |
|---|---|
| PubChem CID | 83542895 |
| Molecular Formula | C6H5Cl2NO3S |
| Molecular Weight | 242.08 g/mol |
| Exact Mass | 240.94 |
| IUPAC Name | 2,4-dichloro-N-hydroxybenzenesulfonamide |
| SMILES | O=S(=O)(NO)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C6H5Cl2NO3S/c7-4-1-2-6(5(8)3-4)13(11,12)9-10/h1-3,9-10H |
| InChIKey | RHCGPTSDMQLIFR-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.08 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|