C7H7Cl2NOS — CID 125424590
(2,4-dichlorophenyl)-imino-methyl-oxo-λ6-sulfane (PubChem CID 125424590) has the molecular formula C7H7Cl2NOS and a molecular weight of 224.11 g/mol. Its IUPAC name is (2,4-dichlorophenyl)-imino-methyl-oxo-λ6-sulfane.
| Compound Name | (2,4-dichlorophenyl)-imino-methyl-oxo-λ6-sulfane |
|---|---|
| PubChem CID | 125424590 |
| Molecular Formula | C7H7Cl2NOS |
| Molecular Weight | 224.11 g/mol |
| Exact Mass | 222.96 |
| IUPAC Name | (2,4-dichlorophenyl)-imino-methyl-oxo-λ6-sulfane |
| SMILES | [H]N=[S@@](C)(=O)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C7H7Cl2NOS/c1-12(10,11)7-3-2-5(8)4-6(7)9/h2-4,10H,1H3/t12-/m0/s1 |
| InChIKey | GGURABUGDWTLCV-LBPRGKRZSA-N |
| XLogP | 3.03 |
| TPSA | 40.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.11 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |