C11H10Cl2N2O2S — CID 59823147
4-(2,4-dichlorophenyl)sulfonyl-3,5-dimethyl-4H-pyrazole (PubChem CID 59823147) has the molecular formula C11H10Cl2N2O2S and a molecular weight of 305.19 g/mol. Its IUPAC name is 4-(2,4-dichlorophenyl)sulfonyl-3,5-dimethyl-4H-pyrazole.
| Compound Name | 4-(2,4-dichlorophenyl)sulfonyl-3,5-dimethyl-4H-pyrazole |
|---|---|
| PubChem CID | 59823147 |
| Molecular Formula | C11H10Cl2N2O2S |
| Molecular Weight | 305.19 g/mol |
| Exact Mass | 303.98 |
| IUPAC Name | 4-(2,4-dichlorophenyl)sulfonyl-3,5-dimethyl-4H-pyrazole |
| SMILES | CC1=NN=C(C)C1S(=O)(=O)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C11H10Cl2N2O2S/c1-6-11(7(2)15-14-6)18(16,17)10-4-3-8(12)5-9(10)13/h3-5,11H,1-2H3 |
| InChIKey | ZVADSSMHENSIAB-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 58.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.19 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |