C10H11Cl2NO2S — CID 118797295
3-(2,4-dichlorophenyl)sulfonylpyrrolidine (PubChem CID 118797295) has the molecular formula C10H11Cl2NO2S and a molecular weight of 280.18 g/mol. Its IUPAC name is 3-(2,4-dichlorophenyl)sulfonylpyrrolidine.
| Compound Name | 3-(2,4-dichlorophenyl)sulfonylpyrrolidine |
|---|---|
| PubChem CID | 118797295 |
| Molecular Formula | C10H11Cl2NO2S |
| Molecular Weight | 280.18 g/mol |
| Exact Mass | 278.99 |
| IUPAC Name | 3-(2,4-dichlorophenyl)sulfonylpyrrolidine |
| SMILES | O=S(=O)(c1ccc(Cl)cc1Cl)C1CCNC1 |
| InChI | InChI=1S/C10H11Cl2NO2S/c11-7-1-2-10(9(12)5-7)16(14,15)8-3-4-13-6-8/h1-2,5,8,13H,3-4,6H2 |
| InChIKey | IZUYFUDBAHYKML-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.18 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |