C10H15N3O2S — CID 71638314
4,6-dimethyl-2-[(3S)-pyrrolidin-3-yl]sulfonylpyrimidine (PubChem CID 71638314) has the molecular formula C10H15N3O2S and a molecular weight of 241.32 g/mol. Its IUPAC name is 4,6-dimethyl-2-[(3S)-pyrrolidin-3-yl]sulfonylpyrimidine.
| Compound Name | 4,6-dimethyl-2-[(3S)-pyrrolidin-3-yl]sulfonylpyrimidine |
|---|---|
| PubChem CID | 71638314 |
| Molecular Formula | C10H15N3O2S |
| Molecular Weight | 241.32 g/mol |
| Exact Mass | 241.09 |
| IUPAC Name | 4,6-dimethyl-2-[(3S)-pyrrolidin-3-yl]sulfonylpyrimidine |
| SMILES | Cc1cc(C)nc(S(=O)(=O)[C@H]2CCNC2)n1 |
| InChI | InChI=1S/C10H15N3O2S/c1-7-5-8(2)13-10(12-7)16(14,15)9-3-4-11-6-9/h5,9,11H,3-4,6H2,1-2H3/t9-/m0/s1 |
| InChIKey | OUYNKENLYLFCKL-VIFPVBQESA-N |
| XLogP | 0.23 |
| TPSA | 71.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.32 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |