C7H12N4O2S — CID 97301297
4-methyl-3-[(3R)-pyrrolidin-3-yl]sulfonyl-1,2,4-triazole (PubChem CID 97301297) has the molecular formula C7H12N4O2S and a molecular weight of 216.27 g/mol. Its IUPAC name is 4-methyl-3-[(3R)-pyrrolidin-3-yl]sulfonyl-1,2,4-triazole.
| Compound Name | 4-methyl-3-[(3R)-pyrrolidin-3-yl]sulfonyl-1,2,4-triazole |
|---|---|
| PubChem CID | 97301297 |
| Molecular Formula | C7H12N4O2S |
| Molecular Weight | 216.27 g/mol |
| Exact Mass | 216.07 |
| IUPAC Name | 4-methyl-3-[(3R)-pyrrolidin-3-yl]sulfonyl-1,2,4-triazole |
| SMILES | Cn1cnnc1S(=O)(=O)[C@@H]1CCNC1 |
| InChI | InChI=1S/C7H12N4O2S/c1-11-5-9-10-7(11)14(12,13)6-2-3-8-4-6/h5-6,8H,2-4H2,1H3/t6-/m1/s1 |
| InChIKey | SAOUCAKMUMJCOC-ZCFIWIBFSA-N |
| XLogP | -1.05 |
| TPSA | 76.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.27 |
| LogP ≤ 5 | -1.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |