C10H15Cl2N3O2S — CID 71639166
4-chloro-6-methyl-2-piperidin-3-ylsulfonylpyrimidine;hydrochloride (PubChem CID 71639166) has the molecular formula C10H15Cl2N3O2S and a molecular weight of 312.22 g/mol. Its IUPAC name is 4-chloro-6-methyl-2-piperidin-3-ylsulfonylpyrimidine;hydrochloride.
| Compound Name | 4-chloro-6-methyl-2-piperidin-3-ylsulfonylpyrimidine;hydrochloride |
|---|---|
| PubChem CID | 71639166 |
| Molecular Formula | C10H15Cl2N3O2S |
| Molecular Weight | 312.22 g/mol |
| Exact Mass | 311.03 |
| IUPAC Name | 4-chloro-6-methyl-2-piperidin-3-ylsulfonylpyrimidine;hydrochloride |
| SMILES | Cc1cc(Cl)nc(S(=O)(=O)C2CCCNC2)n1.Cl |
| InChI | InChI=1S/C10H14ClN3O2S.ClH/c1-7-5-9(11)14-10(13-7)17(15,16)8-3-2-4-12-6-8;/h5,8,12H,2-4,6H2,1H3;1H |
| InChIKey | OOFLISFVNBJELS-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 71.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.22 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |