C8H9Cl2NO2SY-2 — CID 58436491
carbanide;(2,4-dichlorophenyl)sulfonyl-methylazanide;yttrium (PubChem CID 58436491) has the molecular formula C8H9Cl2NO2SY-2 and a molecular weight of 343.04 g/mol. Its IUPAC name is carbanide;(2,4-dichlorophenyl)sulfonyl-methylazanide;yttrium.
| Compound Name | carbanide;(2,4-dichlorophenyl)sulfonyl-methylazanide;yttrium |
|---|---|
| PubChem CID | 58436491 |
| Molecular Formula | C8H9Cl2NO2SY-2 |
| Molecular Weight | 343.04 g/mol |
| Exact Mass | 341.88 |
| IUPAC Name | carbanide;(2,4-dichlorophenyl)sulfonyl-methylazanide;yttrium |
| SMILES | C[N-]S(=O)(=O)c1ccc(Cl)cc1Cl.[CH3-].[Y] |
| InChI | InChI=1S/C7H6Cl2NO2S.CH3.Y/c1-10-13(11,12)7-3-2-5(8)4-6(7)9;;/h2-4H,1H3;1H3;/q2*-1; |
| InChIKey | PSFKHQIEWLSJTQ-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 48.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.04 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|