C6H3Cl5O2S — CID 77134549
sulfuryl dichloride;1,2,4-trichlorobenzene (PubChem CID 77134549) has the molecular formula C6H3Cl5O2S and a molecular weight of 316.42 g/mol. Its IUPAC name is sulfuryl dichloride;1,2,4-trichlorobenzene.
| Compound Name | sulfuryl dichloride;1,2,4-trichlorobenzene |
|---|---|
| PubChem CID | 77134549 |
| Molecular Formula | C6H3Cl5O2S |
| Molecular Weight | 316.42 g/mol |
| Exact Mass | 313.83 |
| IUPAC Name | sulfuryl dichloride;1,2,4-trichlorobenzene |
| SMILES | Clc1ccc(Cl)c(Cl)c1.O=S(=O)(Cl)Cl |
| InChI | InChI=1S/C6H3Cl3.Cl2O2S/c7-4-1-2-5(8)6(9)3-4;1-5(2,3)4/h1-3H; |
| InChIKey | YDWVVPMQZHWQNN-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.42 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|