C6H4Cl3NO2 — CID 174763822
nitrous acid;1,2,4-trichlorobenzene (PubChem CID 174763822) has the molecular formula C6H4Cl3NO2 and a molecular weight of 228.46 g/mol. Its IUPAC name is nitrous acid;1,2,4-trichlorobenzene.
| Compound Name | nitrous acid;1,2,4-trichlorobenzene |
|---|---|
| PubChem CID | 174763822 |
| Molecular Formula | C6H4Cl3NO2 |
| Molecular Weight | 228.46 g/mol |
| Exact Mass | 226.93 |
| IUPAC Name | nitrous acid;1,2,4-trichlorobenzene |
| SMILES | Clc1ccc(Cl)c(Cl)c1.O=NO |
| InChI | InChI=1S/C6H3Cl3.HNO2/c7-4-1-2-5(8)6(9)3-4;2-1-3/h1-3H;(H,2,3) |
| InChIKey | VNAXUEBUDPSUDS-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 49.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.46 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|