C7H7Cl3 — CID 157397102
methane;1,2,4-trichlorobenzene (PubChem CID 157397102) has the molecular formula C7H7Cl3 and a molecular weight of 197.49 g/mol. Its IUPAC name is methane;1,2,4-trichlorobenzene.
| Compound Name | methane;1,2,4-trichlorobenzene |
|---|---|
| PubChem CID | 157397102 |
| Molecular Formula | C7H7Cl3 |
| Molecular Weight | 197.49 g/mol |
| Exact Mass | 195.96 |
| IUPAC Name | methane;1,2,4-trichlorobenzene |
| SMILES | C.Clc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C6H3Cl3.CH4/c7-4-1-2-5(8)6(9)3-4;/h1-3H;1H4 |
| InChIKey | YIEBGLAQINPKSP-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.49 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|