C7H4Cl3N — CID 174386520
formonitrile;1,2,4-trichlorobenzene (PubChem CID 174386520) has the molecular formula C7H4Cl3N and a molecular weight of 208.48 g/mol. Its IUPAC name is formonitrile;1,2,4-trichlorobenzene.
| Compound Name | formonitrile;1,2,4-trichlorobenzene |
|---|---|
| PubChem CID | 174386520 |
| Molecular Formula | C7H4Cl3N |
| Molecular Weight | 208.48 g/mol |
| Exact Mass | 206.94 |
| IUPAC Name | formonitrile;1,2,4-trichlorobenzene |
| SMILES | C#N.Clc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C6H3Cl3.CHN/c7-4-1-2-5(8)6(9)3-4;1-2/h1-3H;1H |
| InChIKey | GMVQVPWEIYICDI-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.48 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|