About 2,4-dichloroaniline;molecular nitrogen
2,4-dichloroaniline;molecular nitrogen (PubChem CID 69010854) has the molecular formula C6H5Cl2N3
and a molecular weight of 190.03 g/mol. Its IUPAC name is 2,4-dichloroaniline;molecular nitrogen.
Molecular Properties
| Compound Name | 2,4-dichloroaniline;molecular nitrogen |
| PubChem CID | 69010854 |
| Molecular Formula | C6H5Cl2N3 |
| Molecular Weight | 190.03 g/mol |
| Exact Mass | 188.99 |
| IUPAC Name | 2,4-dichloroaniline;molecular nitrogen |
| SMILES | N#N.Nc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C6H5Cl2N.N2/c7-4-1-2-6(9)5(8)3-4;1-2/h1-3H,9H2; |
| InChIKey | ANQAOAIZKBJLNA-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 73.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 190.03 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Azo_group', 'substructure': 'N/A'} |
|---|
Analyze 2,4-dichloroaniline;molecular nitrogen with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,4-dichloroaniline;molecular nitrogen?
The IUPAC name of 2,4-dichloroaniline;molecular nitrogen (CID 69010854) is 2,4-dichloroaniline;molecular nitrogen.
What is the SMILES notation for 2,4-dichloroaniline;molecular nitrogen?
The canonical SMILES for 2,4-dichloroaniline;molecular nitrogen is N#N.Nc1ccc(Cl)cc1Cl.
What is the InChIKey of 2,4-dichloroaniline;molecular nitrogen?
The InChIKey is ANQAOAIZKBJLNA-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H5Cl2N.N2/c7-4-1-2-6(9)5(8)3-4;1-2/h1-3H,9H2;.
What are the key properties of 2,4-dichloroaniline;molecular nitrogen?
2,4-dichloroaniline;molecular nitrogen has a molecular weight of 190.03 g/mol, XLogP of 2.61, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4-dichloroaniline;molecular nitrogen is sourced from PubChem (CID 69010854), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).