C10H9ClN2 — CID 21424529
6-chloronaphthalene-1,4-diamine (PubChem CID 21424529) has the molecular formula C10H9ClN2 and a molecular weight of 192.65 g/mol. Its IUPAC name is 6-chloronaphthalene-1,4-diamine.
| Compound Name | 6-chloronaphthalene-1,4-diamine |
|---|---|
| PubChem CID | 21424529 |
| Molecular Formula | C10H9ClN2 |
| Molecular Weight | 192.65 g/mol |
| Exact Mass | 192.05 |
| IUPAC Name | 6-chloronaphthalene-1,4-diamine |
| SMILES | Nc1ccc(N)c2cc(Cl)ccc12 |
| InChI | InChI=1S/C10H9ClN2/c11-6-1-2-7-8(5-6)10(13)4-3-9(7)12/h1-5H,12-13H2 |
| InChIKey | LDUXUAQBQMIKCS-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.65 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|