C12H6Cl5N — CID 81275413
4-chloro-2-(2,3,5,6-tetrachlorophenyl)aniline (PubChem CID 81275413) has the molecular formula C12H6Cl5N and a molecular weight of 341.45 g/mol. Its IUPAC name is 4-chloro-2-(2,3,5,6-tetrachlorophenyl)aniline.
| Compound Name | 4-chloro-2-(2,3,5,6-tetrachlorophenyl)aniline |
|---|---|
| PubChem CID | 81275413 |
| Molecular Formula | C12H6Cl5N |
| Molecular Weight | 341.45 g/mol |
| Exact Mass | 338.89 |
| IUPAC Name | 4-chloro-2-(2,3,5,6-tetrachlorophenyl)aniline |
| SMILES | Nc1ccc(Cl)cc1-c1c(Cl)c(Cl)cc(Cl)c1Cl |
| InChI | InChI=1S/C12H6Cl5N/c13-5-1-2-9(18)6(3-5)10-11(16)7(14)4-8(15)12(10)17/h1-4H,18H2 |
| InChIKey | DQOLUUCHRYHTRN-UHFFFAOYSA-N |
| XLogP | 6.20 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.45 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|