C13H9Cl4N — CID 55197887
4-methyl-2-(2,3,5,6-tetrachlorophenyl)aniline (PubChem CID 55197887) has the molecular formula C13H9Cl4N and a molecular weight of 321.03 g/mol. Its IUPAC name is 4-methyl-2-(2,3,5,6-tetrachlorophenyl)aniline.
| Compound Name | 4-methyl-2-(2,3,5,6-tetrachlorophenyl)aniline |
|---|---|
| PubChem CID | 55197887 |
| Molecular Formula | C13H9Cl4N |
| Molecular Weight | 321.03 g/mol |
| Exact Mass | 318.95 |
| IUPAC Name | 4-methyl-2-(2,3,5,6-tetrachlorophenyl)aniline |
| SMILES | Cc1ccc(N)c(-c2c(Cl)c(Cl)cc(Cl)c2Cl)c1 |
| InChI | InChI=1S/C13H9Cl4N/c1-6-2-3-10(18)7(4-6)11-12(16)8(14)5-9(15)13(11)17/h2-5H,18H2,1H3 |
| InChIKey | ZELTTWIYHYYIMF-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.03 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|