C13H11F2N — CID 61025824
2-(3,5-difluorophenyl)-4-methylaniline (PubChem CID 61025824) has the molecular formula C13H11F2N and a molecular weight of 219.23 g/mol. Its IUPAC name is 2-(3,5-difluorophenyl)-4-methylaniline.
| Compound Name | 2-(3,5-difluorophenyl)-4-methylaniline |
|---|---|
| PubChem CID | 61025824 |
| Molecular Formula | C13H11F2N |
| Molecular Weight | 219.23 g/mol |
| Exact Mass | 219.09 |
| IUPAC Name | 2-(3,5-difluorophenyl)-4-methylaniline |
| SMILES | Cc1ccc(N)c(-c2cc(F)cc(F)c2)c1 |
| InChI | InChI=1S/C13H11F2N/c1-8-2-3-13(16)12(4-8)9-5-10(14)7-11(15)6-9/h2-7H,16H2,1H3 |
| InChIKey | UJPMMKBYAXZKSX-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.23 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|