C14H11F2NO — CID 116581444
(2-amino-5-methylphenyl)-(3,5-difluorophenyl)methanone (PubChem CID 116581444) has the molecular formula C14H11F2NO and a molecular weight of 247.24 g/mol. Its IUPAC name is (2-amino-5-methylphenyl)-(3,5-difluorophenyl)methanone.
| Compound Name | (2-amino-5-methylphenyl)-(3,5-difluorophenyl)methanone |
|---|---|
| PubChem CID | 116581444 |
| Molecular Formula | C14H11F2NO |
| Molecular Weight | 247.24 g/mol |
| Exact Mass | 247.08 |
| IUPAC Name | (2-amino-5-methylphenyl)-(3,5-difluorophenyl)methanone |
| SMILES | Cc1ccc(N)c(C(=O)c2cc(F)cc(F)c2)c1 |
| InChI | InChI=1S/C14H11F2NO/c1-8-2-3-13(17)12(4-8)14(18)9-5-10(15)7-11(16)6-9/h2-7H,17H2,1H3 |
| InChIKey | NGYSFWJFOYFIPO-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.24 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|