C14H11F2NO2 — CID 107469180
(2-amino-3-methoxyphenyl)-(3,5-difluorophenyl)methanone (PubChem CID 107469180) has the molecular formula C14H11F2NO2 and a molecular weight of 263.24 g/mol. Its IUPAC name is (2-amino-3-methoxyphenyl)-(3,5-difluorophenyl)methanone.
| Compound Name | (2-amino-3-methoxyphenyl)-(3,5-difluorophenyl)methanone |
|---|---|
| PubChem CID | 107469180 |
| Molecular Formula | C14H11F2NO2 |
| Molecular Weight | 263.24 g/mol |
| Exact Mass | 263.08 |
| IUPAC Name | (2-amino-3-methoxyphenyl)-(3,5-difluorophenyl)methanone |
| SMILES | COc1cccc(C(=O)c2cc(F)cc(F)c2)c1N |
| InChI | InChI=1S/C14H11F2NO2/c1-19-12-4-2-3-11(13(12)17)14(18)8-5-9(15)7-10(16)6-8/h2-7H,17H2,1H3 |
| InChIKey | PQKQCSWTUNZIFR-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.24 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|