C15H13FO3 — CID 105078663
(2,3-dimethoxyphenyl)-(4-fluorophenyl)methanone (PubChem CID 105078663) has the molecular formula C15H13FO3 and a molecular weight of 260.26 g/mol. Its IUPAC name is (2,3-dimethoxyphenyl)-(4-fluorophenyl)methanone.
| Compound Name | (2,3-dimethoxyphenyl)-(4-fluorophenyl)methanone |
|---|---|
| PubChem CID | 105078663 |
| Molecular Formula | C15H13FO3 |
| Molecular Weight | 260.26 g/mol |
| Exact Mass | 260.08 |
| IUPAC Name | (2,3-dimethoxyphenyl)-(4-fluorophenyl)methanone |
| SMILES | COc1cccc(C(=O)c2ccc(F)cc2)c1OC |
| InChI | InChI=1S/C15H13FO3/c1-18-13-5-3-4-12(15(13)19-2)14(17)10-6-8-11(16)9-7-10/h3-9H,1-2H3 |
| InChIKey | OPYGUWSQQWGQSM-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.26 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |