C16H15FO4 — CID 43588922
(4-fluorophenyl)-(2,3,4-trimethoxyphenyl)methanone (PubChem CID 43588922) has the molecular formula C16H15FO4 and a molecular weight of 290.29 g/mol. Its IUPAC name is (4-fluorophenyl)-(2,3,4-trimethoxyphenyl)methanone.
| Compound Name | (4-fluorophenyl)-(2,3,4-trimethoxyphenyl)methanone |
|---|---|
| PubChem CID | 43588922 |
| Molecular Formula | C16H15FO4 |
| Molecular Weight | 290.29 g/mol |
| Exact Mass | 290.10 |
| IUPAC Name | (4-fluorophenyl)-(2,3,4-trimethoxyphenyl)methanone |
| SMILES | COc1ccc(C(=O)c2ccc(F)cc2)c(OC)c1OC |
| InChI | InChI=1S/C16H15FO4/c1-19-13-9-8-12(15(20-2)16(13)21-3)14(18)10-4-6-11(17)7-5-10/h4-9H,1-3H3 |
| InChIKey | BYJYKNPGADWBOH-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.29 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |