C18H17FO5 — CID 83955702
(Z)-3-(4-fluorophenyl)-2-(2,3,4-trimethoxyphenyl)prop-2-enoic acid (PubChem CID 83955702) has the molecular formula C18H17FO5 and a molecular weight of 332.33 g/mol. Its IUPAC name is (Z)-3-(4-fluorophenyl)-2-(2,3,4-trimethoxyphenyl)prop-2-enoic acid.
| Compound Name | (Z)-3-(4-fluorophenyl)-2-(2,3,4-trimethoxyphenyl)prop-2-enoic acid |
|---|---|
| PubChem CID | 83955702 |
| Molecular Formula | C18H17FO5 |
| Molecular Weight | 332.33 g/mol |
| Exact Mass | 332.11 |
| IUPAC Name | (Z)-3-(4-fluorophenyl)-2-(2,3,4-trimethoxyphenyl)prop-2-enoic acid |
| SMILES | COc1ccc(/C(=C/c2ccc(F)cc2)C(=O)O)c(OC)c1OC |
| InChI | InChI=1S/C18H17FO5/c1-22-15-9-8-13(16(23-2)17(15)24-3)14(18(20)21)10-11-4-6-12(19)7-5-11/h4-10H,1-3H3,(H,20,21)/b14-10- |
| InChIKey | HTNGPCZLQKSTED-UVTDQMKNSA-N |
| XLogP | 3.48 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.33 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|