C19H18F2O5 — CID 10215648
(E)-3-(3,5-difluoro-4-methoxyphenyl)-1-(2,3,4-trimethoxyphenyl)prop-2-en-1-one (PubChem CID 10215648) has the molecular formula C19H18F2O5 and a molecular weight of 364.34 g/mol. Its IUPAC name is (E)-3-(3,5-difluoro-4-methoxyphenyl)-1-(2,3,4-trimethoxyphenyl)prop-2-en-1-one.
| Compound Name | (E)-3-(3,5-difluoro-4-methoxyphenyl)-1-(2,3,4-trimethoxyphenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 10215648 |
| Molecular Formula | C19H18F2O5 |
| Molecular Weight | 364.34 g/mol |
| Exact Mass | 364.11 |
| IUPAC Name | (E)-3-(3,5-difluoro-4-methoxyphenyl)-1-(2,3,4-trimethoxyphenyl)prop-2-en-1-one |
| SMILES | COc1ccc(C(=O)/C=C/c2cc(F)c(OC)c(F)c2)c(OC)c1OC |
| InChI | InChI=1S/C19H18F2O5/c1-23-16-8-6-12(17(24-2)19(16)26-4)15(22)7-5-11-9-13(20)18(25-3)14(21)10-11/h5-10H,1-4H3/b7-5+ |
| InChIKey | CETSHXXRKLPUFX-FNORWQNLSA-N |
| XLogP | 3.90 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.34 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|