C17H15FO4 — CID 8855882
(E)-1-(2-fluorophenyl)-3-(4-hydroxy-3,5-dimethoxyphenyl)prop-2-en-1-one (PubChem CID 8855882) has the molecular formula C17H15FO4 and a molecular weight of 302.30 g/mol. Its IUPAC name is (E)-1-(2-fluorophenyl)-3-(4-hydroxy-3,5-dimethoxyphenyl)prop-2-en-1-one.
| Compound Name | (E)-1-(2-fluorophenyl)-3-(4-hydroxy-3,5-dimethoxyphenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 8855882 |
| Molecular Formula | C17H15FO4 |
| Molecular Weight | 302.30 g/mol |
| Exact Mass | 302.10 |
| IUPAC Name | (E)-1-(2-fluorophenyl)-3-(4-hydroxy-3,5-dimethoxyphenyl)prop-2-en-1-one |
| SMILES | COc1cc(/C=C/C(=O)c2ccccc2F)cc(OC)c1O |
| InChI | InChI=1S/C17H15FO4/c1-21-15-9-11(10-16(22-2)17(15)20)7-8-14(19)12-5-3-4-6-13(12)18/h3-10,20H,1-2H3/b8-7+ |
| InChIKey | CLMIQMALIMOLEB-BQYQJAHWSA-N |
| XLogP | 3.44 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.30 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|