C16H11BrF2O3 — CID 7945623
(E)-3-(3-bromo-4-hydroxy-5-methoxyphenyl)-1-(2,4-difluorophenyl)prop-2-en-1-one (PubChem CID 7945623) has the molecular formula C16H11BrF2O3 and a molecular weight of 369.16 g/mol. Its IUPAC name is (E)-3-(3-bromo-4-hydroxy-5-methoxyphenyl)-1-(2,4-difluorophenyl)prop-2-en-1-one.
| Compound Name | (E)-3-(3-bromo-4-hydroxy-5-methoxyphenyl)-1-(2,4-difluorophenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 7945623 |
| Molecular Formula | C16H11BrF2O3 |
| Molecular Weight | 369.16 g/mol |
| Exact Mass | 367.99 |
| IUPAC Name | (E)-3-(3-bromo-4-hydroxy-5-methoxyphenyl)-1-(2,4-difluorophenyl)prop-2-en-1-one |
| SMILES | COc1cc(/C=C/C(=O)c2ccc(F)cc2F)cc(Br)c1O |
| InChI | InChI=1S/C16H11BrF2O3/c1-22-15-7-9(6-12(17)16(15)21)2-5-14(20)11-4-3-10(18)8-13(11)19/h2-8,21H,1H3/b5-2+ |
| InChIKey | MXYPAFMNXCBBKC-GORDUTHDSA-N |
| XLogP | 4.34 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.16 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|