C17H12F4O3 — CID 75849640
3-[4-(difluoromethoxy)-3-methoxyphenyl]-1-(2,4-difluorophenyl)prop-2-en-1-one (PubChem CID 75849640) has the molecular formula C17H12F4O3 and a molecular weight of 340.27 g/mol. Its IUPAC name is 3-[4-(difluoromethoxy)-3-methoxyphenyl]-1-(2,4-difluorophenyl)prop-2-en-1-one.
| Compound Name | 3-[4-(difluoromethoxy)-3-methoxyphenyl]-1-(2,4-difluorophenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 75849640 |
| Molecular Formula | C17H12F4O3 |
| Molecular Weight | 340.27 g/mol |
| Exact Mass | 340.07 |
| IUPAC Name | 3-[4-(difluoromethoxy)-3-methoxyphenyl]-1-(2,4-difluorophenyl)prop-2-en-1-one |
| SMILES | COc1cc(C=CC(=O)c2ccc(F)cc2F)ccc1OC(F)F |
| InChI | InChI=1S/C17H12F4O3/c1-23-16-8-10(3-7-15(16)24-17(20)21)2-6-14(22)12-5-4-11(18)9-13(12)19/h2-9,17H,1H3 |
| InChIKey | FRASBIQSSDCTLW-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.27 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|