C16H16F2N2O3 — CID 19563214
(E)-3-[4-(difluoromethoxy)-3-methoxyphenyl]-1-(1,5-dimethylpyrazol-4-yl)prop-2-en-1-one (PubChem CID 19563214) has the molecular formula C16H16F2N2O3 and a molecular weight of 322.31 g/mol. Its IUPAC name is (E)-3-[4-(difluoromethoxy)-3-methoxyphenyl]-1-(1,5-dimethylpyrazol-4-yl)prop-2-en-1-one.
| Compound Name | (E)-3-[4-(difluoromethoxy)-3-methoxyphenyl]-1-(1,5-dimethylpyrazol-4-yl)prop-2-en-1-one |
|---|---|
| PubChem CID | 19563214 |
| Molecular Formula | C16H16F2N2O3 |
| Molecular Weight | 322.31 g/mol |
| Exact Mass | 322.11 |
| IUPAC Name | (E)-3-[4-(difluoromethoxy)-3-methoxyphenyl]-1-(1,5-dimethylpyrazol-4-yl)prop-2-en-1-one |
| SMILES | COc1cc(/C=C/C(=O)c2cnn(C)c2C)ccc1OC(F)F |
| InChI | InChI=1S/C16H16F2N2O3/c1-10-12(9-19-20(10)2)13(21)6-4-11-5-7-14(23-16(17)18)15(8-11)22-3/h4-9,16H,1-3H3/b6-4+ |
| InChIKey | LWXMANLUMSTYBJ-GQCTYLIASA-N |
| XLogP | 3.23 |
| TPSA | 53.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.31 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|