C18H13F5O3 — CID 52643894
(E)-3-[4-(difluoromethoxy)-3-methoxyphenyl]-1-[4-(trifluoromethyl)phenyl]prop-2-en-1-one (PubChem CID 52643894) has the molecular formula C18H13F5O3 and a molecular weight of 372.29 g/mol. Its IUPAC name is (E)-3-[4-(difluoromethoxy)-3-methoxyphenyl]-1-[4-(trifluoromethyl)phenyl]prop-2-en-1-one.
| Compound Name | (E)-3-[4-(difluoromethoxy)-3-methoxyphenyl]-1-[4-(trifluoromethyl)phenyl]prop-2-en-1-one |
|---|---|
| PubChem CID | 52643894 |
| Molecular Formula | C18H13F5O3 |
| Molecular Weight | 372.29 g/mol |
| Exact Mass | 372.08 |
| IUPAC Name | (E)-3-[4-(difluoromethoxy)-3-methoxyphenyl]-1-[4-(trifluoromethyl)phenyl]prop-2-en-1-one |
| SMILES | COc1cc(/C=C/C(=O)c2ccc(C(F)(F)F)cc2)ccc1OC(F)F |
| InChI | InChI=1S/C18H13F5O3/c1-25-16-10-11(3-9-15(16)26-17(19)20)2-8-14(24)12-4-6-13(7-5-12)18(21,22)23/h2-10,17H,1H3/b8-2+ |
| InChIKey | OZMAMJVYKZRSRP-KRXBUXKQSA-N |
| XLogP | 5.21 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.29 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|