C17H10F7NO3 — CID 87566152
(E)-3-[3,4-bis(difluoromethoxy)phenyl]-1-[5-(trifluoromethyl)-2-pyridinyl]prop-2-en-1-one (PubChem CID 87566152) has the molecular formula C17H10F7NO3 and a molecular weight of 409.26 g/mol. Its IUPAC name is (E)-3-[3,4-bis(difluoromethoxy)phenyl]-1-[5-(trifluoromethyl)-2-pyridinyl]prop-2-en-1-one.
| Compound Name | (E)-3-[3,4-bis(difluoromethoxy)phenyl]-1-[5-(trifluoromethyl)-2-pyridinyl]prop-2-en-1-one |
|---|---|
| PubChem CID | 87566152 |
| Molecular Formula | C17H10F7NO3 |
| Molecular Weight | 409.26 g/mol |
| Exact Mass | 409.05 |
| IUPAC Name | (E)-3-[3,4-bis(difluoromethoxy)phenyl]-1-[5-(trifluoromethyl)-2-pyridinyl]prop-2-en-1-one |
| SMILES | O=C(/C=C/c1ccc(OC(F)F)c(OC(F)F)c1)c1ccc(C(F)(F)F)cn1 |
| InChI | InChI=1S/C17H10F7NO3/c18-15(19)27-13-6-2-9(7-14(13)28-16(20)21)1-5-12(26)11-4-3-10(8-25-11)17(22,23)24/h1-8,15-16H/b5-1+ |
| InChIKey | SHJDDYZDHZQIDS-ORCRQEGFSA-N |
| XLogP | 5.20 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.26 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|