C11H8F4O3 — CID 169460078
3-[3,4-bis(difluoromethoxy)phenyl]prop-2-enal (PubChem CID 169460078) has the molecular formula C11H8F4O3 and a molecular weight of 264.17 g/mol. Its IUPAC name is 3-[3,4-bis(difluoromethoxy)phenyl]prop-2-enal.
| Compound Name | 3-[3,4-bis(difluoromethoxy)phenyl]prop-2-enal |
|---|---|
| PubChem CID | 169460078 |
| Molecular Formula | C11H8F4O3 |
| Molecular Weight | 264.17 g/mol |
| Exact Mass | 264.04 |
| IUPAC Name | 3-[3,4-bis(difluoromethoxy)phenyl]prop-2-enal |
| SMILES | O=CC=Cc1ccc(OC(F)F)c(OC(F)F)c1 |
| InChI | InChI=1S/C11H8F4O3/c12-10(13)17-8-4-3-7(2-1-5-16)6-9(8)18-11(14)15/h1-6,10-11H |
| InChIKey | SYKCJTPGBUKNIO-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.17 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|