C21H34F2O3Si2 — CID 173241052
3-[3,4-bis[[1-fluorobutyl(dimethyl)silyl]oxy]phenyl]prop-2-enal (PubChem CID 173241052) has the molecular formula C21H34F2O3Si2 and a molecular weight of 428.67 g/mol. Its IUPAC name is 3-[3,4-bis[[1-fluorobutyl(dimethyl)silyl]oxy]phenyl]prop-2-enal.
| Compound Name | 3-[3,4-bis[[1-fluorobutyl(dimethyl)silyl]oxy]phenyl]prop-2-enal |
|---|---|
| PubChem CID | 173241052 |
| Molecular Formula | C21H34F2O3Si2 |
| Molecular Weight | 428.67 g/mol |
| Exact Mass | 428.20 |
| IUPAC Name | 3-[3,4-bis[[1-fluorobutyl(dimethyl)silyl]oxy]phenyl]prop-2-enal |
| SMILES | CCCC(F)[Si](C)(C)Oc1ccc(C=CC=O)cc1O[Si](C)(C)C(F)CCC |
| InChI | InChI=1S/C21H34F2O3Si2/c1-7-10-20(22)27(3,4)25-18-14-13-17(12-9-15-24)16-19(18)26-28(5,6)21(23)11-8-2/h9,12-16,20-21H,7-8,10-11H2,1-6H3 |
| InChIKey | IHWDHRCTDGZKFX-UHFFFAOYSA-N |
| XLogP | 6.42 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.67 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|