C16H12F2O2 — CID 75849637
1-(2,4-difluorophenyl)-3-(2-methoxyphenyl)prop-2-en-1-one (PubChem CID 75849637) has the molecular formula C16H12F2O2 and a molecular weight of 274.27 g/mol. Its IUPAC name is 1-(2,4-difluorophenyl)-3-(2-methoxyphenyl)prop-2-en-1-one.
| Compound Name | 1-(2,4-difluorophenyl)-3-(2-methoxyphenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 75849637 |
| Molecular Formula | C16H12F2O2 |
| Molecular Weight | 274.27 g/mol |
| Exact Mass | 274.08 |
| IUPAC Name | 1-(2,4-difluorophenyl)-3-(2-methoxyphenyl)prop-2-en-1-one |
| SMILES | COc1ccccc1C=CC(=O)c1ccc(F)cc1F |
| InChI | InChI=1S/C16H12F2O2/c1-20-16-5-3-2-4-11(16)6-9-15(19)13-8-7-12(17)10-14(13)18/h2-10H,1H3 |
| InChIKey | AGVZWFLQXFNMIS-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.27 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|