C19H12F2O — CID 7945612
(E)-1-(2,4-difluorophenyl)-3-naphthalen-1-ylprop-2-en-1-one (PubChem CID 7945612) has the molecular formula C19H12F2O and a molecular weight of 294.30 g/mol. Its IUPAC name is (E)-1-(2,4-difluorophenyl)-3-naphthalen-1-ylprop-2-en-1-one.
| Compound Name | (E)-1-(2,4-difluorophenyl)-3-naphthalen-1-ylprop-2-en-1-one |
|---|---|
| PubChem CID | 7945612 |
| Molecular Formula | C19H12F2O |
| Molecular Weight | 294.30 g/mol |
| Exact Mass | 294.09 |
| IUPAC Name | (E)-1-(2,4-difluorophenyl)-3-naphthalen-1-ylprop-2-en-1-one |
| SMILES | O=C(/C=C/c1cccc2ccccc12)c1ccc(F)cc1F |
| InChI | InChI=1S/C19H12F2O/c20-15-9-10-17(18(21)12-15)19(22)11-8-14-6-3-5-13-4-1-2-7-16(13)14/h1-12H/b11-8+ |
| InChIKey | FQRYQBHVUNPXIA-DHZHZOJOSA-N |
| XLogP | 5.01 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.30 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|