C15H9F3O2 — CID 162436453
(E)-3-(2,5-difluorophenyl)-1-(4-fluoro-2-hydroxyphenyl)prop-2-en-1-one (PubChem CID 162436453) has the molecular formula C15H9F3O2 and a molecular weight of 278.23 g/mol. Its IUPAC name is (E)-3-(2,5-difluorophenyl)-1-(4-fluoro-2-hydroxyphenyl)prop-2-en-1-one.
| Compound Name | (E)-3-(2,5-difluorophenyl)-1-(4-fluoro-2-hydroxyphenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 162436453 |
| Molecular Formula | C15H9F3O2 |
| Molecular Weight | 278.23 g/mol |
| Exact Mass | 278.06 |
| IUPAC Name | (E)-3-(2,5-difluorophenyl)-1-(4-fluoro-2-hydroxyphenyl)prop-2-en-1-one |
| SMILES | O=C(/C=C/c1cc(F)ccc1F)c1ccc(F)cc1O |
| InChI | InChI=1S/C15H9F3O2/c16-10-3-5-13(18)9(7-10)1-6-14(19)12-4-2-11(17)8-15(12)20/h1-8,20H/b6-1+ |
| InChIKey | OBSLWEVZQFTDRD-LZCJLJQNSA-N |
| XLogP | 3.71 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.23 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|