C15H11FO4 — CID 169450958
(E)-3-(2-fluorophenyl)-1-(2,3,4-trihydroxyphenyl)prop-2-en-1-one (PubChem CID 169450958) has the molecular formula C15H11FO4 and a molecular weight of 274.25 g/mol. Its IUPAC name is (E)-3-(2-fluorophenyl)-1-(2,3,4-trihydroxyphenyl)prop-2-en-1-one.
| Compound Name | (E)-3-(2-fluorophenyl)-1-(2,3,4-trihydroxyphenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 169450958 |
| Molecular Formula | C15H11FO4 |
| Molecular Weight | 274.25 g/mol |
| Exact Mass | 274.06 |
| IUPAC Name | (E)-3-(2-fluorophenyl)-1-(2,3,4-trihydroxyphenyl)prop-2-en-1-one |
| SMILES | O=C(/C=C/c1ccccc1F)c1ccc(O)c(O)c1O |
| InChI | InChI=1S/C15H11FO4/c16-11-4-2-1-3-9(11)5-7-12(17)10-6-8-13(18)15(20)14(10)19/h1-8,18-20H/b7-5+ |
| InChIKey | IJIDJIJZIUBYDA-FNORWQNLSA-N |
| XLogP | 2.84 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.25 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|