C11H12FNO — CID 76872152
3-(2-fluorophenyl)-N,N-dimethylprop-2-enamide (PubChem CID 76872152) has the molecular formula C11H12FNO and a molecular weight of 193.22 g/mol. Its IUPAC name is 3-(2-fluorophenyl)-N,N-dimethylprop-2-enamide.
| Compound Name | 3-(2-fluorophenyl)-N,N-dimethylprop-2-enamide |
|---|---|
| PubChem CID | 76872152 |
| Molecular Formula | C11H12FNO |
| Molecular Weight | 193.22 g/mol |
| Exact Mass | 193.09 |
| IUPAC Name | 3-(2-fluorophenyl)-N,N-dimethylprop-2-enamide |
| SMILES | CN(C)C(=O)C=Cc1ccccc1F |
| InChI | InChI=1S/C11H12FNO/c1-13(2)11(14)8-7-9-5-3-4-6-10(9)12/h3-8H,1-2H3 |
| InChIKey | UYGCVFVWUSHMGS-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.22 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|