C14H18FNO2 — CID 115691465
(E)-3-(2-fluorophenyl)-N-(3-hydroxybutyl)-N-methylprop-2-enamide (PubChem CID 115691465) has the molecular formula C14H18FNO2 and a molecular weight of 251.30 g/mol. Its IUPAC name is (E)-3-(2-fluorophenyl)-N-(3-hydroxybutyl)-N-methylprop-2-enamide.
| Compound Name | (E)-3-(2-fluorophenyl)-N-(3-hydroxybutyl)-N-methylprop-2-enamide |
|---|---|
| PubChem CID | 115691465 |
| Molecular Formula | C14H18FNO2 |
| Molecular Weight | 251.30 g/mol |
| Exact Mass | 251.13 |
| IUPAC Name | (E)-3-(2-fluorophenyl)-N-(3-hydroxybutyl)-N-methylprop-2-enamide |
| SMILES | CC(O)CCN(C)C(=O)/C=C/c1ccccc1F |
| InChI | InChI=1S/C14H18FNO2/c1-11(17)9-10-16(2)14(18)8-7-12-5-3-4-6-13(12)15/h3-8,11,17H,9-10H2,1-2H3/b8-7+ |
| InChIKey | DIYNJASUKIZTST-BQYQJAHWSA-N |
| XLogP | 2.07 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.30 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|