C13H15Cl2NO2 — CID 76940070
3-(2,3-dichlorophenyl)-N-(2-hydroxypropyl)-N-methylprop-2-enamide (PubChem CID 76940070) has the molecular formula C13H15Cl2NO2 and a molecular weight of 288.17 g/mol. Its IUPAC name is 3-(2,3-dichlorophenyl)-N-(2-hydroxypropyl)-N-methylprop-2-enamide.
| Compound Name | 3-(2,3-dichlorophenyl)-N-(2-hydroxypropyl)-N-methylprop-2-enamide |
|---|---|
| PubChem CID | 76940070 |
| Molecular Formula | C13H15Cl2NO2 |
| Molecular Weight | 288.17 g/mol |
| Exact Mass | 287.05 |
| IUPAC Name | 3-(2,3-dichlorophenyl)-N-(2-hydroxypropyl)-N-methylprop-2-enamide |
| SMILES | CC(O)CN(C)C(=O)C=Cc1cccc(Cl)c1Cl |
| InChI | InChI=1S/C13H15Cl2NO2/c1-9(17)8-16(2)12(18)7-6-10-4-3-5-11(14)13(10)15/h3-7,9,17H,8H2,1-2H3 |
| InChIKey | XHTCFHLNBZVQDU-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.17 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|