C18H14Cl2N2OS — CID 9392949
(E)-N-(1,3-benzothiazol-2-ylmethyl)-3-(2,3-dichlorophenyl)-N-methylprop-2-enamide (PubChem CID 9392949) has the molecular formula C18H14Cl2N2OS and a molecular weight of 377.30 g/mol. Its IUPAC name is (E)-N-(1,3-benzothiazol-2-ylmethyl)-3-(2,3-dichlorophenyl)-N-methylprop-2-enamide.
| Compound Name | (E)-N-(1,3-benzothiazol-2-ylmethyl)-3-(2,3-dichlorophenyl)-N-methylprop-2-enamide |
|---|---|
| PubChem CID | 9392949 |
| Molecular Formula | C18H14Cl2N2OS |
| Molecular Weight | 377.30 g/mol |
| Exact Mass | 376.02 |
| IUPAC Name | (E)-N-(1,3-benzothiazol-2-ylmethyl)-3-(2,3-dichlorophenyl)-N-methylprop-2-enamide |
| SMILES | CN(Cc1nc2ccccc2s1)C(=O)/C=C/c1cccc(Cl)c1Cl |
| InChI | InChI=1S/C18H14Cl2N2OS/c1-22(11-16-21-14-7-2-3-8-15(14)24-16)17(23)10-9-12-5-4-6-13(19)18(12)20/h2-10H,11H2,1H3/b10-9+ |
| InChIKey | MKSLZVGQDFMNJV-MDZDMXLPSA-N |
| XLogP | 5.27 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.30 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|