C22H23ClN2O3S — CID 26419183
(E)-N-(1,3-benzothiazol-2-ylmethyl)-3-(3-chloro-5-methoxy-4-propoxyphenyl)-N-methylprop-2-enamide (PubChem CID 26419183) has the molecular formula C22H23ClN2O3S and a molecular weight of 430.96 g/mol. Its IUPAC name is (E)-N-(1,3-benzothiazol-2-ylmethyl)-3-(3-chloro-5-methoxy-4-propoxyphenyl)-N-methylprop-2-enamide.
| Compound Name | (E)-N-(1,3-benzothiazol-2-ylmethyl)-3-(3-chloro-5-methoxy-4-propoxyphenyl)-N-methylprop-2-enamide |
|---|---|
| PubChem CID | 26419183 |
| Molecular Formula | C22H23ClN2O3S |
| Molecular Weight | 430.96 g/mol |
| Exact Mass | 430.11 |
| IUPAC Name | (E)-N-(1,3-benzothiazol-2-ylmethyl)-3-(3-chloro-5-methoxy-4-propoxyphenyl)-N-methylprop-2-enamide |
| SMILES | CCCOc1c(Cl)cc(/C=C/C(=O)N(C)Cc2nc3ccccc3s2)cc1OC |
| InChI | InChI=1S/C22H23ClN2O3S/c1-4-11-28-22-16(23)12-15(13-18(22)27-3)9-10-21(26)25(2)14-20-24-17-7-5-6-8-19(17)29-20/h5-10,12-13H,4,11,14H2,1-3H3/b10-9+ |
| InChIKey | CKIUIMQQUPFABT-MDZDMXLPSA-N |
| XLogP | 5.42 |
| TPSA | 51.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.96 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|