C24H29ClN2O4 — CID 26619838
(E)-3-(3-chloro-5-methoxy-4-propoxyphenyl)-N-[2-(2,6-dimethylanilino)-2-oxoethyl]-N-methylprop-2-enamide (PubChem CID 26619838) has the molecular formula C24H29ClN2O4 and a molecular weight of 444.96 g/mol. Its IUPAC name is (E)-3-(3-chloro-5-methoxy-4-propoxyphenyl)-N-[2-(2,6-dimethylanilino)-2-oxoethyl]-N-methylprop-2-enamide.
| Compound Name | (E)-3-(3-chloro-5-methoxy-4-propoxyphenyl)-N-[2-(2,6-dimethylanilino)-2-oxoethyl]-N-methylprop-2-enamide |
|---|---|
| PubChem CID | 26619838 |
| Molecular Formula | C24H29ClN2O4 |
| Molecular Weight | 444.96 g/mol |
| Exact Mass | 444.18 |
| IUPAC Name | (E)-3-(3-chloro-5-methoxy-4-propoxyphenyl)-N-[2-(2,6-dimethylanilino)-2-oxoethyl]-N-methylprop-2-enamide |
| SMILES | CCCOc1c(Cl)cc(/C=C/C(=O)N(C)CC(=O)Nc2c(C)cccc2C)cc1OC |
| InChI | InChI=1S/C24H29ClN2O4/c1-6-12-31-24-19(25)13-18(14-20(24)30-5)10-11-22(29)27(4)15-21(28)26-23-16(2)8-7-9-17(23)3/h7-11,13-14H,6,12,15H2,1-5H3,(H,26,28)/b11-10+ |
| InChIKey | KKLZFNLEQCRDGD-ZHACJKMWSA-N |
| XLogP | 4.86 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.96 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|