C11H11Cl2NO2 — CID 97305734
(Z)-3-(2,3-dichlorophenyl)-N-methoxy-N-methylprop-2-enamide (PubChem CID 97305734) has the molecular formula C11H11Cl2NO2 and a molecular weight of 260.12 g/mol. Its IUPAC name is (Z)-3-(2,3-dichlorophenyl)-N-methoxy-N-methylprop-2-enamide.
| Compound Name | (Z)-3-(2,3-dichlorophenyl)-N-methoxy-N-methylprop-2-enamide |
|---|---|
| PubChem CID | 97305734 |
| Molecular Formula | C11H11Cl2NO2 |
| Molecular Weight | 260.12 g/mol |
| Exact Mass | 259.02 |
| IUPAC Name | (Z)-3-(2,3-dichlorophenyl)-N-methoxy-N-methylprop-2-enamide |
| SMILES | CON(C)C(=O)/C=C\c1cccc(Cl)c1Cl |
| InChI | InChI=1S/C11H11Cl2NO2/c1-14(16-2)10(15)7-6-8-4-3-5-9(12)11(8)13/h3-7H,1-2H3/b7-6- |
| InChIKey | HEICTZIWUQNDDN-SREVYHEPSA-N |
| XLogP | 3.03 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.12 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|