C9H5Cl2O2- — CID 2063719
(E)-3-(2,3-dichlorophenyl)prop-2-enoate (PubChem CID 2063719) has the molecular formula C9H5Cl2O2- and a molecular weight of 216.04 g/mol. Its IUPAC name is (E)-3-(2,3-dichlorophenyl)prop-2-enoate.
| Compound Name | (E)-3-(2,3-dichlorophenyl)prop-2-enoate |
|---|---|
| PubChem CID | 2063719 |
| Molecular Formula | C9H5Cl2O2- |
| Molecular Weight | 216.04 g/mol |
| Exact Mass | 214.97 |
| IUPAC Name | (E)-3-(2,3-dichlorophenyl)prop-2-enoate |
| SMILES | O=C([O-])/C=C/c1cccc(Cl)c1Cl |
| InChI | InChI=1S/C9H6Cl2O2/c10-7-3-1-2-6(9(7)11)4-5-8(12)13/h1-5H,(H,12,13)/p-1/b5-4+ |
| InChIKey | RCEWIEGWGDHVNK-SNAWJCMRSA-M |
| XLogP | 1.76 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.04 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|