C15H9Cl2F2NO — CID 76859976
3-(2,3-dichlorophenyl)-N-(2,6-difluorophenyl)prop-2-enamide (PubChem CID 76859976) has the molecular formula C15H9Cl2F2NO and a molecular weight of 328.15 g/mol. Its IUPAC name is 3-(2,3-dichlorophenyl)-N-(2,6-difluorophenyl)prop-2-enamide.
| Compound Name | 3-(2,3-dichlorophenyl)-N-(2,6-difluorophenyl)prop-2-enamide |
|---|---|
| PubChem CID | 76859976 |
| Molecular Formula | C15H9Cl2F2NO |
| Molecular Weight | 328.15 g/mol |
| Exact Mass | 327.00 |
| IUPAC Name | 3-(2,3-dichlorophenyl)-N-(2,6-difluorophenyl)prop-2-enamide |
| SMILES | O=C(C=Cc1cccc(Cl)c1Cl)Nc1c(F)cccc1F |
| InChI | InChI=1S/C15H9Cl2F2NO/c16-10-4-1-3-9(14(10)17)7-8-13(21)20-15-11(18)5-2-6-12(15)19/h1-8H,(H,20,21) |
| InChIKey | OYWXDVBICKQGKP-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.15 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|